| D008689 |
Methacrylates |
Acrylic acids or acrylates which are substituted in the C-2 position with a methyl group. |
Methacrylate |
|
| D009113 |
Muramidase |
A basic enzyme that is present in saliva, tears, egg white, and many animal fluids. It functions as an antibacterial agent. The enzyme catalyzes the hydrolysis of 1,4-beta-linkages between N-acetylmuramic acid and N-acetyl-D-glucosamine residues in peptidoglycan and between N-acetyl-D-glucosamine residues in chitodextrin. EC 3.2.1.17. |
Lysozyme,Leftose,N-Acetylmuramide Glycanhydrolase,Glycanhydrolase, N-Acetylmuramide,N Acetylmuramide Glycanhydrolase |
|
| D010100 |
Oxygen |
An element with atomic symbol O, atomic number 8, and atomic weight [15.99903; 15.99977]. It is the most abundant element on earth and essential for respiration. |
Dioxygen,Oxygen-16,Oxygen 16 |
|
| D010539 |
Permeability |
Property of membranes and other structures to permit passage of light, heat, gases, liquids, metabolites, and mineral ions. |
Permeabilities |
|
| D011092 |
Polyethylene Glycols |
Polymers of ETHYLENE OXIDE and water, and their ethers. They vary in consistency from liquid to solid depending on the molecular weight indicated by a number following the name. They are used as SURFACTANTS, dispersing agents, solvents, ointment and suppository bases, vehicles, and tablet excipients. Some specific groups are NONOXYNOLS, OCTOXYNOLS, and POLOXAMERS. |
Macrogols,Polyoxyethylenes,Carbowax,Macrogol,Polyethylene Glycol,Polyethylene Oxide,Polyethyleneoxide,Polyglycol,Glycol, Polyethylene,Glycols, Polyethylene,Oxide, Polyethylene,Oxides, Polyethylene,Polyethylene Oxides,Polyethyleneoxides,Polyglycols,Polyoxyethylene |
|
| D011760 |
Pyrrolidinones |
A group of compounds that are derivatives of oxo-pyrrolidines. A member of this group is 2-oxo pyrrolidine, which is an intermediate in the manufacture of polyvinylpyrrolidone. (From Merck Index, 11th ed) |
Pyrrolidinone,Pyrrolidone,Pyrrolidones |
|
| D000327 |
Adsorption |
The adhesion of gases, liquids, or dissolved solids onto a surface. It includes adsorptive phenomena of bacteria and viruses onto surfaces as well. ABSORPTION into the substance may follow but not necessarily. |
Adsorptions |
|
| D013056 |
Spectrophotometry, Ultraviolet |
Determination of the spectra of ultraviolet absorption by specific molecules in gases or liquids, for example Cl2, SO2, NO2, CS2, ozone, mercury vapor, and various unsaturated compounds. (McGraw-Hill Dictionary of Scientific and Technical Terms, 4th ed) |
Ultraviolet Spectrophotometry |
|
| D020136 |
Hydrogel, Polyethylene Glycol Dimethacrylate |
A network of cross-linked hydrophilic macromolecules used in biomedical applications fabricated by photopolymerization of polyethylene glycol dimethacrylate. Its general formulae is C3H5C(O)(OCH2CH2)nOC(O)C3H5 where n denotes a number of average polyglycol (OCH2CH2) repeats. |
PEG-DMA Hydrogel,PEGDMA Hydrogel,Polyethylene Glycol Dimethacrylate Hydrogel,Hydrogel, PEG-DMA,Hydrogel, PEGDMA,PEG DMA Hydrogel,PEG-DMA Hydrogels,PEGDMA Hydrogels |
|