BIOMAT Database Logo BIOMAT Database Logo

2,2-Dichloro-N-(4-chloro-phenyl-sulfon-yl)-acetamide. 2008

B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess

In the crystal structure of the title compound (N4CPSDCAA), C(8)H(6)Cl(3)NO(3)S, the conformations of the N-H and C=O bonds in the SO(2)-NH-CO-C group are trans to each other, similar to those observed in 2,2-dichloro-N-(phenyl-sulfon-yl)-acetamide (NPSDCAA), 2,2-dichloro-N-(4-methyl-phenyl-sulfon-yl)acetamide (N4MPSDCAA) and N-(4-chloro-phenyl-sulfon-yl)-2,2,2-trimethyl-acetamide (N4CPSTMAA), with similar bond parameters. The -SNHCOC- unit in N4CPSDCAA is essentially planar and makes a dihedral angle of 79.67 (5)° with the benzene ring, comparable to 79.75 (8)° in NPSDCAA, 81.02 (5)° in N4MPSDCAA and 82.2 (1)° in N4CPSTMAA. The mol-ecules in N4CPSDCAA are linked into layers parallel to the (001) plane by inter-molecular N-H⋯O hydrogen bonds.

UI MeSH Term Description Entries

Related Publications

B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-[4-(4-Chloro-benzene-sulfonamido)-phenyl-sulfon-yl]acetamide.
June 2012, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-(4-Chloro-pyridin-2-yl)-N-(4-methyl-phenyl-sulfon-yl)acetamide.
November 2010, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-[(4-Chloro-phen-yl)sulfon-yl]acetamide.
September 2012, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-(4-Chloro-2-nitro-phen-yl)-N-(methyl-sulfon-yl)acetamide.
October 2008, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-(4-Chloro-phen-yl)-2,2-diphenyl-acetamide.
August 2012, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-[(4-Methyl-phen-yl)sulfon-yl]acetamide.
July 2012, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-(3-Chloro-4-fluoro-phen-yl)-2,2-diphenyl-acetamide.
October 2011, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-[Bis(morpholin-4-yl)phosphino-yl]-2-chloro-2,2-difluoro-acetamide.
August 2011, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
N-(2-Nitro-phenyl-sulfon-yl)-N-(4-nitro-phenyl-sulfon-yl)methyl-amine.
September 2008, Acta crystallographica. Section E, Structure reports online,
B Thimme Gowda, and Sabine Foro, and P G Nirmala, and B P Sowmya, and Hartmut Fuess
A triclinic polymorph of N-[4-(4-methyl-benzene-sulfonamido)-phenyl-sulfon-yl]acetamide.
April 2012, Acta crystallographica. Section E, Structure reports online,
Copied contents to your clipboard!