| D004337 |
Drug Carriers |
Forms to which substances are incorporated to improve the delivery and the effectiveness of drugs. Drug carriers are used in drug-delivery systems such as the controlled-release technology to prolong in vivo drug actions, decrease drug metabolism, and reduce drug toxicity. Carriers are also used in designs to increase the effectiveness of drug delivery to the target sites of pharmacological actions. Liposomes, albumin microspheres, soluble synthetic polymers, DNA complexes, protein-drug conjugates, and carrier erythrocytes among others have been employed as biodegradable drug carriers. |
Drug Carrier |
|
| D006603 |
Hexuronic Acids |
Term used to designate tetrahydroxy aldehydic acids obtained by oxidation of hexose sugars, i.e. glucuronic acid, galacturonic acid, etc. Historically, the name hexuronic acid was originally given to ascorbic acid. |
Hexouronic Acids,Acids, Hexouronic,Acids, Hexuronic |
|
| D006801 |
Humans |
Members of the species Homo sapiens. |
Homo sapiens,Man (Taxonomy),Human,Man, Modern,Modern Man |
|
| D000464 |
Alginates |
Salts and esters of ALGINIC ACID that are used as HYDROGELS; DENTAL IMPRESSION MATERIALS, and as absorbent materials for surgical dressings (BANDAGES, HYDROCOLLOID). They are also used to manufacture MICROSPHERES and NANOPARTICLES for DIAGNOSTIC REAGENT KITS and DRUG DELIVERY SYSTEMS. |
Alginate,Alginic Acid, Barium Salt,Alginic Acid, Calcium Salt,Alginic Acid, Copper Salt,Alginic Acid, Potassium Salt,Alginic Acid, Sodium Salt,Alloid G,Barium Alginate,Calcium Alginate,Calginat,Copper Alginate,Kalrostat,Kalrostat 2,Kaltostat,Potassium Alginate,Sodium Alginate,Sodium Calcium Alginate,Vocoloid,Xantalgin,poly(Mannuronic Acid), Sodium Salt,Alginate, Barium,Alginate, Calcium,Alginate, Copper,Alginate, Potassium,Alginate, Sodium,Alginate, Sodium Calcium,Calcium Alginate, Sodium |
|
| D000818 |
Animals |
Unicellular or multicellular, heterotrophic organisms, that have sensation and the power of voluntary movement. Under the older five kingdom paradigm, Animalia was one of the kingdoms. Under the modern three domain model, Animalia represents one of the many groups in the domain EUKARYOTA. |
Animal,Metazoa,Animalia |
|
| D017690 |
Cell Transplantation |
Transference of cells within an individual, between individuals of the same species, or between individuals of different species. |
Transplantation, Cell |
|
| D020136 |
Hydrogel, Polyethylene Glycol Dimethacrylate |
A network of cross-linked hydrophilic macromolecules used in biomedical applications fabricated by photopolymerization of polyethylene glycol dimethacrylate. Its general formulae is C3H5C(O)(OCH2CH2)nOC(O)C3H5 where n denotes a number of average polyglycol (OCH2CH2) repeats. |
PEG-DMA Hydrogel,PEGDMA Hydrogel,Polyethylene Glycol Dimethacrylate Hydrogel,Hydrogel, PEG-DMA,Hydrogel, PEGDMA,PEG DMA Hydrogel,PEG-DMA Hydrogels,PEGDMA Hydrogels |
|
| D020723 |
Glucuronic Acid |
A sugar acid formed by the oxidation of the C-6 carbon of GLUCOSE. In addition to being a key intermediate metabolite of the uronic acid pathway, glucuronic acid also plays a role in the detoxification of certain drugs and toxins by conjugating with them to form GLUCURONIDES. |
Glucuronate,Glucuronic Acid, 6-(14)C-labeled, (D)-isomer,Glucuronic Acid, Monopotassium Salt,Glucuronic Acid, Monosodium Salt,Monopotassium Glucuronate,Monosodium Glucuronate,Glucuronate, Monopotassium,Glucuronate, Monosodium |
|
-transparent.png){kind=logo}
