| D010455 |
Peptides |
Members of the class of compounds composed of AMINO ACIDS joined together by peptide bonds between adjacent amino acids into linear, branched or cyclical structures. OLIGOPEPTIDES are composed of approximately 2-12 amino acids. Polypeptides are composed of approximately 13 or more amino acids. PROTEINS are considered to be larger versions of peptides that can form into complex structures such as ENZYMES and RECEPTORS. |
Peptide,Polypeptide,Polypeptides |
|
| D011108 |
Polymers |
Compounds formed by the joining of smaller, usually repeating, units linked by covalent bonds. These compounds often form large macromolecules (e.g., BIOPOLYMERS; PLASTICS). |
Polymer |
|
| D004548 |
Elasticity |
Resistance and recovery from distortion of shape. |
|
|
| D006801 |
Humans |
Members of the species Homo sapiens. |
Homo sapiens,Man (Taxonomy),Human,Man, Modern,Modern Man |
|
| D001672 |
Biocompatible Materials |
Synthetic or natural materials, other than DRUGS, that are used to replace or repair any body TISSUES or bodily function. |
Biomaterials,Bioartificial Materials,Hemocompatible Materials,Bioartificial Material,Biocompatible Material,Biomaterial,Hemocompatible Material,Material, Bioartificial,Material, Biocompatible,Material, Hemocompatible |
|
| D016503 |
Drug Delivery Systems |
Systems for the delivery of drugs to target sites of pharmacological actions. Technologies employed include those concerning drug preparation, route of administration, site targeting, metabolism, and toxicity. |
Drug Targeting,Delivery System, Drug,Delivery Systems, Drug,Drug Delivery System,Drug Targetings,System, Drug Delivery,Systems, Drug Delivery,Targeting, Drug,Targetings, Drug |
|
| D020135 |
Peptide Nucleic Acids |
DNA analogs containing neutral amide backbone linkages composed of aminoethyl glycine units instead of the usual phosphodiester linkage of deoxyribose groups. Peptide nucleic acids have high biological stability and higher affinity for complementary DNA or RNA sequences than analogous DNA oligomers. |
Peptide Nucleic Acid,Acid, Peptide Nucleic,Acids, Peptide Nucleic,Nucleic Acid, Peptide,Nucleic Acids, Peptide |
|
| D020136 |
Hydrogel, Polyethylene Glycol Dimethacrylate |
A network of cross-linked hydrophilic macromolecules used in biomedical applications fabricated by photopolymerization of polyethylene glycol dimethacrylate. Its general formulae is C3H5C(O)(OCH2CH2)nOC(O)C3H5 where n denotes a number of average polyglycol (OCH2CH2) repeats. |
PEG-DMA Hydrogel,PEGDMA Hydrogel,Polyethylene Glycol Dimethacrylate Hydrogel,Hydrogel, PEG-DMA,Hydrogel, PEGDMA,PEG DMA Hydrogel,PEG-DMA Hydrogels,PEGDMA Hydrogels |
|
| D023822 |
Tissue Engineering |
Generating tissue in vitro for clinical applications, such as replacing wounded tissues or impaired organs. The use of TISSUE SCAFFOLDING enables the generation of complex multi-layered tissues and tissue structures. |
Engineering, Tissue |
|